C10H11N5O4S2 — CID 107785681
3-amino-4-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]benzenesulfonamide (PubChem CID 107785681) has the molecular formula C10H11N5O4S2 and a molecular weight of 329.36 g/mol. Its IUPAC name is 3-amino-4-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]benzenesulfonamide.
| Compound Name | 3-amino-4-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]benzenesulfonamide |
|---|---|
| PubChem CID | 107785681 |
| Molecular Formula | C10H11N5O4S2 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | 3-amino-4-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]benzenesulfonamide |
| SMILES | Cn1[nH]c(=O)c(=O)nc1Sc1ccc(S(N)(=O)=O)cc1N |
| InChI | InChI=1S/C10H11N5O4S2/c1-15-10(13-8(16)9(17)14-15)20-7-3-2-5(4-6(7)11)21(12,18)19/h2-4H,11H2,1H3,(H,14,17)(H2,12,18,19) |
| InChIKey | MAUWYQPIXAKRQU-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 153.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|