C10H6Cl2N4O3S — CID 107189533
2,3-dichloro-N-(3-methyl-1,2,4-thiadiazol-5-yl)-5-nitrobenzamide (PubChem CID 107189533) has the molecular formula C10H6Cl2N4O3S and a molecular weight of 333.16 g/mol. Its IUPAC name is 2,3-dichloro-N-(3-methyl-1,2,4-thiadiazol-5-yl)-5-nitrobenzamide.
| Compound Name | 2,3-dichloro-N-(3-methyl-1,2,4-thiadiazol-5-yl)-5-nitrobenzamide |
|---|---|
| PubChem CID | 107189533 |
| Molecular Formula | C10H6Cl2N4O3S |
| Molecular Weight | 333.16 g/mol |
| Exact Mass | 331.95 |
| IUPAC Name | 2,3-dichloro-N-(3-methyl-1,2,4-thiadiazol-5-yl)-5-nitrobenzamide |
| SMILES | Cc1nsc(NC(=O)c2cc([N+](=O)[O-])cc(Cl)c2Cl)n1 |
| InChI | InChI=1S/C10H6Cl2N4O3S/c1-4-13-10(20-15-4)14-9(17)6-2-5(16(18)19)3-7(11)8(6)12/h2-3H,1H3,(H,13,14,15,17) |
| InChIKey | XWRNCUYSESIZSG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.16 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|