C12H14BrFO2S — CID 107758007
2-bromo-3-fluoro-4-(3-methylbutylsulfanyl)benzoic acid (PubChem CID 107758007) has the molecular formula C12H14BrFO2S and a molecular weight of 321.21 g/mol. Its IUPAC name is 2-bromo-3-fluoro-4-(3-methylbutylsulfanyl)benzoic acid.
| Compound Name | 2-bromo-3-fluoro-4-(3-methylbutylsulfanyl)benzoic acid |
|---|---|
| PubChem CID | 107758007 |
| Molecular Formula | C12H14BrFO2S |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 319.99 |
| IUPAC Name | 2-bromo-3-fluoro-4-(3-methylbutylsulfanyl)benzoic acid |
| SMILES | CC(C)CCSc1ccc(C(=O)O)c(Br)c1F |
| InChI | InChI=1S/C12H14BrFO2S/c1-7(2)5-6-17-9-4-3-8(12(15)16)10(13)11(9)14/h3-4,7H,5-6H2,1-2H3,(H,15,16) |
| InChIKey | OUHDHNKPPWXYGK-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |