About 5-bromo-2-(1,3-oxazol-2-ylsulfanyl)pyridine-3-carboxylic acid
5-bromo-2-(1,3-oxazol-2-ylsulfanyl)pyridine-3-carboxylic acid (PubChem CID 106921120) has the molecular formula C9H5BrN2O3S
and a molecular weight of 301.12 g/mol. Its IUPAC name is 5-bromo-2-(1,3-oxazol-2-ylsulfanyl)pyridine-3-carboxylic acid.
Analyze 5-bromo-2-(1,3-oxazol-2-ylsulfanyl)pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-(1,3-oxazol-2-ylsulfanyl)pyridine-3-carboxylic acid?
The IUPAC name of 5-bromo-2-(1,3-oxazol-2-ylsulfanyl)pyridine-3-carboxylic acid (CID 106921120) is 5-bromo-2-(1,3-oxazol-2-ylsulfanyl)pyridine-3-carboxylic acid.
What is the SMILES notation for 5-bromo-2-(1,3-oxazol-2-ylsulfanyl)pyridine-3-carboxylic acid?
The canonical SMILES for 5-bromo-2-(1,3-oxazol-2-ylsulfanyl)pyridine-3-carboxylic acid is O=C(O)c1cc(Br)cnc1Sc1ncco1.
What is the InChIKey of 5-bromo-2-(1,3-oxazol-2-ylsulfanyl)pyridine-3-carboxylic acid?
The InChIKey is YIFGPSXFXVFOGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5BrN2O3S/c10-5-3-6(8(13)14)7(12-4-5)16-9-11-1-2-15-9/h1-4H,(H,13,14).
What are the key properties of 5-bromo-2-(1,3-oxazol-2-ylsulfanyl)pyridine-3-carboxylic acid?
5-bromo-2-(1,3-oxazol-2-ylsulfanyl)pyridine-3-carboxylic acid has a molecular weight of 301.12 g/mol, XLogP of 2.68, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-(1,3-oxazol-2-ylsulfanyl)pyridine-3-carboxylic acid is sourced from PubChem (CID 106921120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).