C14H6Br8F2 — CID 91295525
1,2,3,5-tetrabromo-4-(fluoromethyl)benzene;1,2,4,5-tetrabromo-3-fluoro-6-methylbenzene (PubChem CID 91295525) has the molecular formula C14H6Br8F2 and a molecular weight of 851.43 g/mol. Its IUPAC name is 1,2,3,5-tetrabromo-4-(fluoromethyl)benzene;1,2,4,5-tetrabromo-3-fluoro-6-methylbenzene.
| Compound Name | 1,2,3,5-tetrabromo-4-(fluoromethyl)benzene;1,2,4,5-tetrabromo-3-fluoro-6-methylbenzene |
|---|---|
| PubChem CID | 91295525 |
| Molecular Formula | C14H6Br8F2 |
| Molecular Weight | 851.43 g/mol |
| Exact Mass | 843.39 |
| IUPAC Name | 1,2,3,5-tetrabromo-4-(fluoromethyl)benzene;1,2,4,5-tetrabromo-3-fluoro-6-methylbenzene |
| SMILES | Cc1c(Br)c(Br)c(F)c(Br)c1Br.FCc1c(Br)cc(Br)c(Br)c1Br |
| InChI | InChI=1S/2C7H3Br4F/c8-4-1-5(9)7(11)6(10)3(4)2-12;1-2-3(8)5(10)7(12)6(11)4(2)9/h1H,2H2;1H3 |
| InChIKey | DRYXXQWLJRBYHQ-UHFFFAOYSA-N |
| XLogP | 10.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.43 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|