C14H8Br6F2 — CID 90857577
1,3-dibromo-2-(fluoromethyl)benzene;1,2,4,5-tetrabromo-3-fluoro-6-methylbenzene (PubChem CID 90857577) has the molecular formula C14H8Br6F2 and a molecular weight of 693.64 g/mol. Its IUPAC name is 1,3-dibromo-2-(fluoromethyl)benzene;1,2,4,5-tetrabromo-3-fluoro-6-methylbenzene.
| Compound Name | 1,3-dibromo-2-(fluoromethyl)benzene;1,2,4,5-tetrabromo-3-fluoro-6-methylbenzene |
|---|---|
| PubChem CID | 90857577 |
| Molecular Formula | C14H8Br6F2 |
| Molecular Weight | 693.64 g/mol |
| Exact Mass | 687.57 |
| IUPAC Name | 1,3-dibromo-2-(fluoromethyl)benzene;1,2,4,5-tetrabromo-3-fluoro-6-methylbenzene |
| SMILES | Cc1c(Br)c(Br)c(F)c(Br)c1Br.FCc1c(Br)cccc1Br |
| InChI | InChI=1S/C7H3Br4F.C7H5Br2F/c1-2-3(8)5(10)7(12)6(11)4(2)9;8-6-2-1-3-7(9)5(6)4-10/h1H3;1-3H,4H2 |
| InChIKey | SONMNSHCZNCDQD-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.64 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|