C7H4ClF3 — CID 23325936
1-chloro-2,3-difluoro-5-(fluoromethyl)benzene (PubChem CID 23325936) has the molecular formula C7H4ClF3 and a molecular weight of 180.56 g/mol. Its IUPAC name is 1-chloro-2,3-difluoro-5-(fluoromethyl)benzene.
| Compound Name | 1-chloro-2,3-difluoro-5-(fluoromethyl)benzene |
|---|---|
| PubChem CID | 23325936 |
| Molecular Formula | C7H4ClF3 |
| Molecular Weight | 180.56 g/mol |
| Exact Mass | 180.00 |
| IUPAC Name | 1-chloro-2,3-difluoro-5-(fluoromethyl)benzene |
| SMILES | FCc1cc(F)c(F)c(Cl)c1 |
| InChI | InChI=1S/C7H4ClF3/c8-5-1-4(3-9)2-6(10)7(5)11/h1-2H,3H2 |
| InChIKey | JJIXQKKYZGGMEQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.56 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|