C13H9ClF3N — CID 114275253
[4-(6-chloro-2,3-difluorophenyl)-3-fluorophenyl]methanamine (PubChem CID 114275253) has the molecular formula C13H9ClF3N and a molecular weight of 271.67 g/mol. Its IUPAC name is [4-(6-chloro-2,3-difluorophenyl)-3-fluorophenyl]methanamine.
| Compound Name | [4-(6-chloro-2,3-difluorophenyl)-3-fluorophenyl]methanamine |
|---|---|
| PubChem CID | 114275253 |
| Molecular Formula | C13H9ClF3N |
| Molecular Weight | 271.67 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | [4-(6-chloro-2,3-difluorophenyl)-3-fluorophenyl]methanamine |
| SMILES | NCc1ccc(-c2c(Cl)ccc(F)c2F)c(F)c1 |
| InChI | InChI=1S/C13H9ClF3N/c14-9-3-4-10(15)13(17)12(9)8-2-1-7(6-18)5-11(8)16/h1-5H,6,18H2 |
| InChIKey | LIECVJJWHXGZES-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.67 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|