C8H9Cl2N — CID 15670830
2-(3,5-dichlorophenyl)ethanamine (PubChem CID 15670830) has the molecular formula C8H9Cl2N and a molecular weight of 190.07 g/mol. Its IUPAC name is 2-(3,5-dichlorophenyl)ethanamine.
| Compound Name | 2-(3,5-dichlorophenyl)ethanamine |
|---|---|
| PubChem CID | 15670830 |
| Molecular Formula | C8H9Cl2N |
| Molecular Weight | 190.07 g/mol |
| Exact Mass | 189.01 |
| IUPAC Name | 2-(3,5-dichlorophenyl)ethanamine |
| SMILES | NCCc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C8H9Cl2N/c9-7-3-6(1-2-11)4-8(10)5-7/h3-5H,1-2,11H2 |
| InChIKey | HEEUTZAJXBKBEJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.07 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |