C11H12ClFO — CID 117305933
3-(3-chloro-2-fluoro-5,6-dimethylphenyl)propanal (PubChem CID 117305933) has the molecular formula C11H12ClFO and a molecular weight of 214.67 g/mol. Its IUPAC name is 3-(3-chloro-2-fluoro-5,6-dimethylphenyl)propanal.
| Compound Name | 3-(3-chloro-2-fluoro-5,6-dimethylphenyl)propanal |
|---|---|
| PubChem CID | 117305933 |
| Molecular Formula | C11H12ClFO |
| Molecular Weight | 214.67 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 3-(3-chloro-2-fluoro-5,6-dimethylphenyl)propanal |
| SMILES | Cc1cc(Cl)c(F)c(CCC=O)c1C |
| InChI | InChI=1S/C11H12ClFO/c1-7-6-10(12)11(13)9(8(7)2)4-3-5-14/h5-6H,3-4H2,1-2H3 |
| InChIKey | KNTOCFHXUCOHRO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.67 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|