C12H16O2 — CID 117117757
3-(2-hydroxy-3,4,6-trimethylphenyl)propanal (PubChem CID 117117757) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 3-(2-hydroxy-3,4,6-trimethylphenyl)propanal.
| Compound Name | 3-(2-hydroxy-3,4,6-trimethylphenyl)propanal |
|---|---|
| PubChem CID | 117117757 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 3-(2-hydroxy-3,4,6-trimethylphenyl)propanal |
| SMILES | Cc1cc(C)c(CCC=O)c(O)c1C |
| InChI | InChI=1S/C12H16O2/c1-8-7-9(2)11(5-4-6-13)12(14)10(8)3/h6-7,14H,4-5H2,1-3H3 |
| InChIKey | DTUICDYVJRYOCA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|