C11H14O2 — CID 117277791
3-(2-hydroxy-4,5-dimethylphenyl)propanal (PubChem CID 117277791) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is 3-(2-hydroxy-4,5-dimethylphenyl)propanal.
| Compound Name | 3-(2-hydroxy-4,5-dimethylphenyl)propanal |
|---|---|
| PubChem CID | 117277791 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 3-(2-hydroxy-4,5-dimethylphenyl)propanal |
| SMILES | Cc1cc(O)c(CCC=O)cc1C |
| InChI | InChI=1S/C11H14O2/c1-8-6-10(4-3-5-12)11(13)7-9(8)2/h5-7,13H,3-4H2,1-2H3 |
| InChIKey | PUIFMPABZXMFPE-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|