C12H16O3S — CID 117353709
3-(4,5-dimethyl-2-methylsulfonylphenyl)propanal (PubChem CID 117353709) has the molecular formula C12H16O3S and a molecular weight of 240.32 g/mol. Its IUPAC name is 3-(4,5-dimethyl-2-methylsulfonylphenyl)propanal.
| Compound Name | 3-(4,5-dimethyl-2-methylsulfonylphenyl)propanal |
|---|---|
| PubChem CID | 117353709 |
| Molecular Formula | C12H16O3S |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 3-(4,5-dimethyl-2-methylsulfonylphenyl)propanal |
| SMILES | Cc1cc(CCC=O)c(S(C)(=O)=O)cc1C |
| InChI | InChI=1S/C12H16O3S/c1-9-7-11(5-4-6-13)12(8-10(9)2)16(3,14)15/h6-8H,4-5H2,1-3H3 |
| InChIKey | RMQLHUPMPXGZRJ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|