C11H16O2 — CID 117114395
2-(2-hydroxyethyl)-3,5,6-trimethylphenol (PubChem CID 117114395) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-(2-hydroxyethyl)-3,5,6-trimethylphenol.
| Compound Name | 2-(2-hydroxyethyl)-3,5,6-trimethylphenol |
|---|---|
| PubChem CID | 117114395 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 2-(2-hydroxyethyl)-3,5,6-trimethylphenol |
| SMILES | Cc1cc(C)c(CCO)c(O)c1C |
| InChI | InChI=1S/C11H16O2/c1-7-6-8(2)10(4-5-12)11(13)9(7)3/h6,12-13H,4-5H2,1-3H3 |
| InChIKey | NTOMZECZVPKADS-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |