C9H7ClF2O — CID 53434308
3-(3-chloro-2,6-difluorophenyl)propanal (PubChem CID 53434308) has the molecular formula C9H7ClF2O and a molecular weight of 204.60 g/mol. Its IUPAC name is 3-(3-chloro-2,6-difluorophenyl)propanal.
| Compound Name | 3-(3-chloro-2,6-difluorophenyl)propanal |
|---|---|
| PubChem CID | 53434308 |
| Molecular Formula | C9H7ClF2O |
| Molecular Weight | 204.60 g/mol |
| Exact Mass | 204.02 |
| IUPAC Name | 3-(3-chloro-2,6-difluorophenyl)propanal |
| SMILES | O=CCCc1c(F)ccc(Cl)c1F |
| InChI | InChI=1S/C9H7ClF2O/c10-7-3-4-8(11)6(9(7)12)2-1-5-13/h3-5H,1-2H2 |
| InChIKey | PLQKQHKSFJOSHB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.60 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|