C18H20N2O5 — CID 135528685
4-(2,5,8,11-tetraoxabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yldiazenyl)phenol (PubChem CID 135528685) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is 4-(2,5,8,11-tetraoxabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yldiazenyl)phenol.
| Compound Name | 4-(2,5,8,11-tetraoxabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yldiazenyl)phenol |
|---|---|
| PubChem CID | 135528685 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 4-(2,5,8,11-tetraoxabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yldiazenyl)phenol |
| SMILES | Oc1ccc(/N=N/c2ccc3c(c2)OCCOCCOCCO3)cc1 |
| InChI | InChI=1S/C18H20N2O5/c21-16-4-1-14(2-5-16)19-20-15-3-6-17-18(13-15)25-12-10-23-8-7-22-9-11-24-17/h1-6,13,21H,7-12H2/b20-19+ |
| InChIKey | NFOZGOISUGYISC-FMQUCBEESA-N |
| XLogP | 3.61 |
| TPSA | 81.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|