C36H49N3O12 — CID 102468859
(Z)-3-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-ylamino)-2-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-yliminomethyl)prop-2-enenitrile (PubChem CID 102468859) has the molecular formula C36H49N3O12 and a molecular weight of 715.80 g/mol. Its IUPAC name is (Z)-3-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-ylamino)-2-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-yliminomethyl)prop-2-enenitrile.
| Compound Name | (Z)-3-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-ylamino)-2-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-yliminomethyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 102468859 |
| Molecular Formula | C36H49N3O12 |
| Molecular Weight | 715.80 g/mol |
| Exact Mass | 715.33 |
| IUPAC Name | (Z)-3-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-ylamino)-2-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-yliminomethyl)prop-2-enenitrile |
| SMILES | N#CC(=C\Nc1ccc2c(c1)OCCOCCOCCOCCOCCO2)/C=N/c1ccc2c(c1)OCCOCCOCCOCCOCCO2 |
| InChI | InChI=1S/C36H49N3O12/c37-27-30(28-38-31-1-3-33-35(25-31)50-23-19-46-15-11-42-7-5-40-9-13-44-17-21-48-33)29-39-32-2-4-34-36(26-32)51-24-20-47-16-12-43-8-6-41-10-14-45-18-22-49-34/h1-4,25-26,28-29,38H,5-24H2/b30-28+,39-29+ |
| InChIKey | HYFLYGWAGOLSRD-QPNCLPDGSA-N |
| XLogP | 3.58 |
| TPSA | 158.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.80 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|