C29H30N2O5 — CID 102273367
4-[(E)-2-[4-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-ylamino)phenyl]ethenyl]benzonitrile (PubChem CID 102273367) has the molecular formula C29H30N2O5 and a molecular weight of 486.57 g/mol. Its IUPAC name is 4-[(E)-2-[4-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-ylamino)phenyl]ethenyl]benzonitrile.
| Compound Name | 4-[(E)-2-[4-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-ylamino)phenyl]ethenyl]benzonitrile |
|---|---|
| PubChem CID | 102273367 |
| Molecular Formula | C29H30N2O5 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | 4-[(E)-2-[4-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-ylamino)phenyl]ethenyl]benzonitrile |
| SMILES | N#Cc1ccc(/C=C/c2ccc(Nc3ccc4c(c3)OCCOCCOCCOCCO4)cc2)cc1 |
| InChI | InChI=1S/C29H30N2O5/c30-22-25-5-3-23(4-6-25)1-2-24-7-9-26(10-8-24)31-27-11-12-28-29(21-27)36-20-18-34-16-14-32-13-15-33-17-19-35-28/h1-12,21,31H,13-20H2/b2-1+ |
| InChIKey | KLHNSILVJJSAIL-OWOJBTEDSA-N |
| XLogP | 5.29 |
| TPSA | 81.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|