C15H13N3O2 — CID 104716240
2-amino-3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)benzonitrile (PubChem CID 104716240) has the molecular formula C15H13N3O2 and a molecular weight of 267.29 g/mol. Its IUPAC name is 2-amino-3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)benzonitrile.
| Compound Name | 2-amino-3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)benzonitrile |
|---|---|
| PubChem CID | 104716240 |
| Molecular Formula | C15H13N3O2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 2-amino-3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)benzonitrile |
| SMILES | N#Cc1cccc(Nc2ccc3c(c2)OCCO3)c1N |
| InChI | InChI=1S/C15H13N3O2/c16-9-10-2-1-3-12(15(10)17)18-11-4-5-13-14(8-11)20-7-6-19-13/h1-5,8,18H,6-7,17H2 |
| InChIKey | GJDASBMWTSULFW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 80.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|