C14H9FN2O2 — CID 115367105
4-(1,3-benzodioxol-5-ylamino)-2-fluorobenzonitrile (PubChem CID 115367105) has the molecular formula C14H9FN2O2 and a molecular weight of 256.24 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylamino)-2-fluorobenzonitrile.
| Compound Name | 4-(1,3-benzodioxol-5-ylamino)-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 115367105 |
| Molecular Formula | C14H9FN2O2 |
| Molecular Weight | 256.24 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylamino)-2-fluorobenzonitrile |
| SMILES | N#Cc1ccc(Nc2ccc3c(c2)OCO3)cc1F |
| InChI | InChI=1S/C14H9FN2O2/c15-12-5-10(2-1-9(12)7-16)17-11-3-4-13-14(6-11)19-8-18-13/h1-6,17H,8H2 |
| InChIKey | BMHMAPGXBVDTFN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.24 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |