C14H8F2N2O2 — CID 81283181
4-(1,3-benzodioxol-5-ylamino)-3,5-difluorobenzonitrile (PubChem CID 81283181) has the molecular formula C14H8F2N2O2 and a molecular weight of 274.23 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylamino)-3,5-difluorobenzonitrile.
| Compound Name | 4-(1,3-benzodioxol-5-ylamino)-3,5-difluorobenzonitrile |
|---|---|
| PubChem CID | 81283181 |
| Molecular Formula | C14H8F2N2O2 |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylamino)-3,5-difluorobenzonitrile |
| SMILES | N#Cc1cc(F)c(Nc2ccc3c(c2)OCO3)c(F)c1 |
| InChI | InChI=1S/C14H8F2N2O2/c15-10-3-8(6-17)4-11(16)14(10)18-9-1-2-12-13(5-9)20-7-19-12/h1-5,18H,7H2 |
| InChIKey | YHTVAKOGAJLPRU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |