C14H11N3O2 — CID 104711408
4-amino-3-(1,3-benzodioxol-5-ylamino)benzonitrile (PubChem CID 104711408) has the molecular formula C14H11N3O2 and a molecular weight of 253.26 g/mol. Its IUPAC name is 4-amino-3-(1,3-benzodioxol-5-ylamino)benzonitrile.
| Compound Name | 4-amino-3-(1,3-benzodioxol-5-ylamino)benzonitrile |
|---|---|
| PubChem CID | 104711408 |
| Molecular Formula | C14H11N3O2 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 4-amino-3-(1,3-benzodioxol-5-ylamino)benzonitrile |
| SMILES | N#Cc1ccc(N)c(Nc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C14H11N3O2/c15-7-9-1-3-11(16)12(5-9)17-10-2-4-13-14(6-10)19-8-18-13/h1-6,17H,8,16H2 |
| InChIKey | OPVKESMWVIXTON-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 80.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|