C13H13N3O4S — CID 43153447
3-amino-4-(1,3-benzodioxol-5-ylamino)benzenesulfonamide (PubChem CID 43153447) has the molecular formula C13H13N3O4S and a molecular weight of 307.33 g/mol. Its IUPAC name is 3-amino-4-(1,3-benzodioxol-5-ylamino)benzenesulfonamide.
| Compound Name | 3-amino-4-(1,3-benzodioxol-5-ylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 43153447 |
| Molecular Formula | C13H13N3O4S |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 3-amino-4-(1,3-benzodioxol-5-ylamino)benzenesulfonamide |
| SMILES | Nc1cc(S(N)(=O)=O)ccc1Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H13N3O4S/c14-10-6-9(21(15,17)18)2-3-11(10)16-8-1-4-12-13(5-8)20-7-19-12/h1-6,16H,7,14H2,(H2,15,17,18) |
| InChIKey | JFBHALWVPVIPMV-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|