C14H12N2O5S — CID 145207270
N-(4-methylsulfonyl-2-nitrosophenyl)-1,3-benzodioxol-5-amine (PubChem CID 145207270) has the molecular formula C14H12N2O5S and a molecular weight of 320.33 g/mol. Its IUPAC name is N-(4-methylsulfonyl-2-nitrosophenyl)-1,3-benzodioxol-5-amine.
| Compound Name | N-(4-methylsulfonyl-2-nitrosophenyl)-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 145207270 |
| Molecular Formula | C14H12N2O5S |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | N-(4-methylsulfonyl-2-nitrosophenyl)-1,3-benzodioxol-5-amine |
| SMILES | CS(=O)(=O)c1ccc(Nc2ccc3c(c2)OCO3)c(N=O)c1 |
| InChI | InChI=1S/C14H12N2O5S/c1-22(18,19)10-3-4-11(12(7-10)16-17)15-9-2-5-13-14(6-9)21-8-20-13/h2-7,15H,8H2,1H3 |
| InChIKey | DIFYIIVMWRFBPC-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |