C19H13N3O2 — CID 21001885
2-(1,3-benzodioxol-5-ylamino)-5-phenylpyridine-3-carbonitrile (PubChem CID 21001885) has the molecular formula C19H13N3O2 and a molecular weight of 315.33 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylamino)-5-phenylpyridine-3-carbonitrile.
| Compound Name | 2-(1,3-benzodioxol-5-ylamino)-5-phenylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 21001885 |
| Molecular Formula | C19H13N3O2 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylamino)-5-phenylpyridine-3-carbonitrile |
| SMILES | N#Cc1cc(-c2ccccc2)cnc1Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H13N3O2/c20-10-14-8-15(13-4-2-1-3-5-13)11-21-19(14)22-16-6-7-17-18(9-16)24-12-23-17/h1-9,11H,12H2,(H,21,22) |
| InChIKey | RMIJZWCLPKBUGT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |