C13H11N3O4 — CID 81440039
5-amino-6-(1,3-benzodioxol-5-ylamino)pyridine-3-carboxylic acid (PubChem CID 81440039) has the molecular formula C13H11N3O4 and a molecular weight of 273.25 g/mol. Its IUPAC name is 5-amino-6-(1,3-benzodioxol-5-ylamino)pyridine-3-carboxylic acid.
| Compound Name | 5-amino-6-(1,3-benzodioxol-5-ylamino)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 81440039 |
| Molecular Formula | C13H11N3O4 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 5-amino-6-(1,3-benzodioxol-5-ylamino)pyridine-3-carboxylic acid |
| SMILES | Nc1cc(C(=O)O)cnc1Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H11N3O4/c14-9-3-7(13(17)18)5-15-12(9)16-8-1-2-10-11(4-8)20-6-19-10/h1-5H,6,14H2,(H,15,16)(H,17,18) |
| InChIKey | TZRDUUTZHADDCL-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |