C13H14N4O2 — CID 80759767
4-N-(1,3-benzodioxol-5-yl)-5-ethylpyrimidine-4,6-diamine (PubChem CID 80759767) has the molecular formula C13H14N4O2 and a molecular weight of 258.28 g/mol. Its IUPAC name is 4-N-(1,3-benzodioxol-5-yl)-5-ethylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(1,3-benzodioxol-5-yl)-5-ethylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80759767 |
| Molecular Formula | C13H14N4O2 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 4-N-(1,3-benzodioxol-5-yl)-5-ethylpyrimidine-4,6-diamine |
| SMILES | CCc1c(N)ncnc1Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H14N4O2/c1-2-9-12(14)15-6-16-13(9)17-8-3-4-10-11(5-8)19-7-18-10/h3-6H,2,7H2,1H3,(H3,14,15,16,17) |
| InChIKey | KWHYEPKYTWCQAD-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |