C22H26N2O8 — CID 12669108
2-[4-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yldiazenyl)phenoxy]acetic acid (PubChem CID 12669108) has the molecular formula C22H26N2O8 and a molecular weight of 446.46 g/mol. Its IUPAC name is 2-[4-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yldiazenyl)phenoxy]acetic acid.
| Compound Name | 2-[4-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yldiazenyl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 12669108 |
| Molecular Formula | C22H26N2O8 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 2-[4-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yldiazenyl)phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(/N=N/c2ccc3c(c2)OCCOCCOCCOCCO3)cc1 |
| InChI | InChI=1S/C22H26N2O8/c25-22(26)16-32-19-4-1-17(2-5-19)23-24-18-3-6-20-21(15-18)31-14-12-29-10-8-27-7-9-28-11-13-30-20/h1-6,15H,7-14,16H2,(H,25,26)/b24-23+ |
| InChIKey | GWOUDJJZDFLGLC-WCWDXBQESA-N |
| XLogP | 3.39 |
| TPSA | 117.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|