C40H38N6O6 — CID 102505998
1-[[25-[(2-aminonaphthalen-1-yl)diazenyl]-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaen-11-yl]diazenyl]naphthalen-2-amine (PubChem CID 102505998) has the molecular formula C40H38N6O6 and a molecular weight of 698.78 g/mol. Its IUPAC name is 1-[[25-[(2-aminonaphthalen-1-yl)diazenyl]-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaen-11-yl]diazenyl]naphthalen-2-amine.
| Compound Name | 1-[[25-[(2-aminonaphthalen-1-yl)diazenyl]-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaen-11-yl]diazenyl]naphthalen-2-amine |
|---|---|
| PubChem CID | 102505998 |
| Molecular Formula | C40H38N6O6 |
| Molecular Weight | 698.78 g/mol |
| Exact Mass | 698.29 |
| IUPAC Name | 1-[[25-[(2-aminonaphthalen-1-yl)diazenyl]-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaen-11-yl]diazenyl]naphthalen-2-amine |
| SMILES | Nc1ccc2ccccc2c1/N=N/c1ccc2c(c1)OCCOCCOc1cc(/N=N/c3c(N)ccc4ccccc34)ccc1OCCOCCO2 |
| InChI | InChI=1S/C40H38N6O6/c41-33-13-9-27-5-1-3-7-31(27)39(33)45-43-29-11-15-35-37(25-29)51-23-19-48-20-24-52-38-26-30(12-16-36(38)50-22-18-47-17-21-49-35)44-46-40-32-8-4-2-6-28(32)10-14-34(40)42/h1-16,25-26H,17-24,41-42H2/b45-43+,46-44+ |
| InChIKey | BXWYGXAPMLHOKT-MWOVFPFUSA-N |
| XLogP | 9.25 |
| TPSA | 156.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.78 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|