C23H17N5O — CID 134332917
7-[(2-aminonaphthalen-1-yl)diazenyl]-N-(methylideneamino)dibenzofuran-3-amine (PubChem CID 134332917) has the molecular formula C23H17N5O and a molecular weight of 379.42 g/mol. Its IUPAC name is 7-[(2-aminonaphthalen-1-yl)diazenyl]-N-(methylideneamino)dibenzofuran-3-amine.
| Compound Name | 7-[(2-aminonaphthalen-1-yl)diazenyl]-N-(methylideneamino)dibenzofuran-3-amine |
|---|---|
| PubChem CID | 134332917 |
| Molecular Formula | C23H17N5O |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 7-[(2-aminonaphthalen-1-yl)diazenyl]-N-(methylideneamino)dibenzofuran-3-amine |
| SMILES | C=NNc1ccc2c(c1)oc1cc(/N=N/c3c(N)ccc4ccccc34)ccc12 |
| InChI | InChI=1S/C23H17N5O/c1-25-26-15-7-9-18-19-10-8-16(13-22(19)29-21(18)12-15)27-28-23-17-5-3-2-4-14(17)6-11-20(23)24/h2-13,26H,1,24H2/b28-27+ |
| InChIKey | VPBAEXULDNFTBI-BYYHNAKLSA-N |
| XLogP | 6.76 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|