C19H17FO3 — CID 6248752
(E)-3-(4-fluorophenyl)-1-(2,3,4,5-tetrahydro-1,6-benzodioxocin-8-yl)prop-2-en-1-one (PubChem CID 6248752) has the molecular formula C19H17FO3 and a molecular weight of 312.34 g/mol. Its IUPAC name is (E)-3-(4-fluorophenyl)-1-(2,3,4,5-tetrahydro-1,6-benzodioxocin-8-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(4-fluorophenyl)-1-(2,3,4,5-tetrahydro-1,6-benzodioxocin-8-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 6248752 |
| Molecular Formula | C19H17FO3 |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | (E)-3-(4-fluorophenyl)-1-(2,3,4,5-tetrahydro-1,6-benzodioxocin-8-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(F)cc1)c1ccc2c(c1)OCCCCO2 |
| InChI | InChI=1S/C19H17FO3/c20-16-7-3-14(4-8-16)5-9-17(21)15-6-10-18-19(13-15)23-12-2-1-11-22-18/h3-10,13H,1-2,11-12H2/b9-5+ |
| InChIKey | QJLNWEQOQFYFAY-WEVVVXLNSA-N |
| XLogP | 4.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|