C17H15Cl2FN2O — CID 126139532
N-(3,4-dichlorophenyl)-1-(3-fluoro-4-morpholin-4-ylphenyl)methanimine (PubChem CID 126139532) has the molecular formula C17H15Cl2FN2O and a molecular weight of 353.22 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-1-(3-fluoro-4-morpholin-4-ylphenyl)methanimine.
| Compound Name | N-(3,4-dichlorophenyl)-1-(3-fluoro-4-morpholin-4-ylphenyl)methanimine |
|---|---|
| PubChem CID | 126139532 |
| Molecular Formula | C17H15Cl2FN2O |
| Molecular Weight | 353.22 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | N-(3,4-dichlorophenyl)-1-(3-fluoro-4-morpholin-4-ylphenyl)methanimine |
| SMILES | Fc1cc(/C=N/c2ccc(Cl)c(Cl)c2)ccc1N1CCOCC1 |
| InChI | InChI=1S/C17H15Cl2FN2O/c18-14-3-2-13(10-15(14)19)21-11-12-1-4-17(16(20)9-12)22-5-7-23-8-6-22/h1-4,9-11H,5-8H2/b21-11+ |
| InChIKey | PKRUFVXGWLEKGY-SRZZPIQSSA-N |
| XLogP | 4.72 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.22 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|