C21H17ClN2O4S — CID 3604636
5-(1,3-benzodioxol-5-ylmethylideneamino)-N-(3-chlorophenyl)-2-methylbenzenesulfonamide (PubChem CID 3604636) has the molecular formula C21H17ClN2O4S and a molecular weight of 428.90 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-ylmethylideneamino)-N-(3-chlorophenyl)-2-methylbenzenesulfonamide.
| Compound Name | 5-(1,3-benzodioxol-5-ylmethylideneamino)-N-(3-chlorophenyl)-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 3604636 |
| Molecular Formula | C21H17ClN2O4S |
| Molecular Weight | 428.90 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | 5-(1,3-benzodioxol-5-ylmethylideneamino)-N-(3-chlorophenyl)-2-methylbenzenesulfonamide |
| SMILES | Cc1ccc(/N=C/c2ccc3c(c2)OCO3)cc1S(=O)(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C21H17ClN2O4S/c1-14-5-7-17(23-12-15-6-8-19-20(9-15)28-13-27-19)11-21(14)29(25,26)24-18-4-2-3-16(22)10-18/h2-12,24H,13H2,1H3/b23-12+ |
| InChIKey | YNFPSSBAVIJKLY-FSJBWODESA-N |
| XLogP | 4.93 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.90 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|