C16H18N2O3S2 — CID 3579489
N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)-1-thiophen-2-ylmethanimine (PubChem CID 3579489) has the molecular formula C16H18N2O3S2 and a molecular weight of 350.47 g/mol. Its IUPAC name is N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)-1-thiophen-2-ylmethanimine.
| Compound Name | N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)-1-thiophen-2-ylmethanimine |
|---|---|
| PubChem CID | 3579489 |
| Molecular Formula | C16H18N2O3S2 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)-1-thiophen-2-ylmethanimine |
| SMILES | Cc1ccc(/N=C/c2cccs2)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C16H18N2O3S2/c1-13-4-5-14(17-12-15-3-2-10-22-15)11-16(13)23(19,20)18-6-8-21-9-7-18/h2-5,10-12H,6-9H2,1H3/b17-12+ |
| InChIKey | NWHMRRXELCILPD-SFQUDFHCSA-N |
| XLogP | 2.83 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|