C16H20BrN2O2S2+ — CID 8814484
1-(5-bromo-2-methylphenyl)sulfonyl-4-(thiophen-2-ylmethyl)piperazin-4-ium (PubChem CID 8814484) has the molecular formula C16H20BrN2O2S2+ and a molecular weight of 416.39 g/mol. Its IUPAC name is 1-(5-bromo-2-methylphenyl)sulfonyl-4-(thiophen-2-ylmethyl)piperazin-4-ium.
| Compound Name | 1-(5-bromo-2-methylphenyl)sulfonyl-4-(thiophen-2-ylmethyl)piperazin-4-ium |
|---|---|
| PubChem CID | 8814484 |
| Molecular Formula | C16H20BrN2O2S2+ |
| Molecular Weight | 416.39 g/mol |
| Exact Mass | 415.01 |
| IUPAC Name | 1-(5-bromo-2-methylphenyl)sulfonyl-4-(thiophen-2-ylmethyl)piperazin-4-ium |
| SMILES | Cc1ccc(Br)cc1S(=O)(=O)N1CC[NH+](Cc2cccs2)CC1 |
| InChI | InChI=1S/C16H19BrN2O2S2/c1-13-4-5-14(17)11-16(13)23(20,21)19-8-6-18(7-9-19)12-15-3-2-10-22-15/h2-5,10-11H,6-9,12H2,1H3/p+1 |
| InChIKey | KMTFOWXKEADSAR-UHFFFAOYSA-O |
| XLogP | 1.91 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.39 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |