C18H17ClN2O6 — CID 73242600
2-[2-[4-(dimethylamino)phenyl]ethenyl]-1,3-benzoxazin-4-one;perchloric acid (PubChem CID 73242600) has the molecular formula C18H17ClN2O6 and a molecular weight of 392.80 g/mol. Its IUPAC name is 2-[2-[4-(dimethylamino)phenyl]ethenyl]-1,3-benzoxazin-4-one;perchloric acid.
| Compound Name | 2-[2-[4-(dimethylamino)phenyl]ethenyl]-1,3-benzoxazin-4-one;perchloric acid |
|---|---|
| PubChem CID | 73242600 |
| Molecular Formula | C18H17ClN2O6 |
| Molecular Weight | 392.80 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 2-[2-[4-(dimethylamino)phenyl]ethenyl]-1,3-benzoxazin-4-one;perchloric acid |
| SMILES | CN(C)c1ccc(C=Cc2nc(=O)c3ccccc3o2)cc1.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C18H16N2O2.ClHO4/c1-20(2)14-10-7-13(8-11-14)9-12-17-19-18(21)15-5-3-4-6-16(15)22-17;2-1(3,4)5/h3-12H,1-2H3;(H,2,3,4,5) |
| InChIKey | QCIJMSIXLDEPQQ-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 135.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.80 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|