C17H13NO3 — CID 3122852
2-[2-(4-methoxyphenyl)ethenyl]-1,3-benzoxazin-4-one (PubChem CID 3122852) has the molecular formula C17H13NO3 and a molecular weight of 279.30 g/mol. Its IUPAC name is 2-[2-(4-methoxyphenyl)ethenyl]-1,3-benzoxazin-4-one.
| Compound Name | 2-[2-(4-methoxyphenyl)ethenyl]-1,3-benzoxazin-4-one |
|---|---|
| PubChem CID | 3122852 |
| Molecular Formula | C17H13NO3 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 2-[2-(4-methoxyphenyl)ethenyl]-1,3-benzoxazin-4-one |
| SMILES | COc1ccc(C=Cc2nc(=O)c3ccccc3o2)cc1 |
| InChI | InChI=1S/C17H13NO3/c1-20-13-9-6-12(7-10-13)8-11-16-18-17(19)14-4-2-3-5-15(14)21-16/h2-11H,1H3 |
| InChIKey | TWCMCYYZVRDTPJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |