C28H25NO6 — CID 86589200
[3-(2,5-dimethoxyphenyl)-4-methyl-2-oxochromen-7-yl] 3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 86589200) has the molecular formula C28H25NO6 and a molecular weight of 471.51 g/mol. Its IUPAC name is [3-(2,5-dimethoxyphenyl)-4-methyl-2-oxochromen-7-yl] 3,4-dihydro-2H-quinoline-1-carboxylate.
| Compound Name | [3-(2,5-dimethoxyphenyl)-4-methyl-2-oxochromen-7-yl] 3,4-dihydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 86589200 |
| Molecular Formula | C28H25NO6 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | [3-(2,5-dimethoxyphenyl)-4-methyl-2-oxochromen-7-yl] 3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | COc1ccc(OC)c(-c2c(C)c3ccc(OC(=O)N4CCCc5ccccc54)cc3oc2=O)c1 |
| InChI | InChI=1S/C28H25NO6/c1-17-21-12-10-20(34-28(31)29-14-6-8-18-7-4-5-9-23(18)29)16-25(21)35-27(30)26(17)22-15-19(32-2)11-13-24(22)33-3/h4-5,7,9-13,15-16H,6,8,14H2,1-3H3 |
| InChIKey | JOXWTXCYRPIOAB-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 78.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|