C20H17NO4 — CID 5262372
3-(3,4-dihydro-2H-quinoline-1-carbonyl)-7-methoxychromen-2-one (PubChem CID 5262372) has the molecular formula C20H17NO4 and a molecular weight of 335.36 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-quinoline-1-carbonyl)-7-methoxychromen-2-one.
| Compound Name | 3-(3,4-dihydro-2H-quinoline-1-carbonyl)-7-methoxychromen-2-one |
|---|---|
| PubChem CID | 5262372 |
| Molecular Formula | C20H17NO4 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 3-(3,4-dihydro-2H-quinoline-1-carbonyl)-7-methoxychromen-2-one |
| SMILES | COc1ccc2cc(C(=O)N3CCCc4ccccc43)c(=O)oc2c1 |
| InChI | InChI=1S/C20H17NO4/c1-24-15-9-8-14-11-16(20(23)25-18(14)12-15)19(22)21-10-4-6-13-5-2-3-7-17(13)21/h2-3,5,7-9,11-12H,4,6,10H2,1H3 |
| InChIKey | MJHMCOYHVHNLJC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|