C20H17NO4 — CID 2238171
6-methoxy-3-[(2R)-2-methyl-2,3-dihydroindole-1-carbonyl]chromen-2-one (PubChem CID 2238171) has the molecular formula C20H17NO4 and a molecular weight of 335.36 g/mol. Its IUPAC name is 6-methoxy-3-[(2R)-2-methyl-2,3-dihydroindole-1-carbonyl]chromen-2-one.
| Compound Name | 6-methoxy-3-[(2R)-2-methyl-2,3-dihydroindole-1-carbonyl]chromen-2-one |
|---|---|
| PubChem CID | 2238171 |
| Molecular Formula | C20H17NO4 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 6-methoxy-3-[(2R)-2-methyl-2,3-dihydroindole-1-carbonyl]chromen-2-one |
| SMILES | COc1ccc2oc(=O)c(C(=O)N3c4ccccc4C[C@H]3C)cc2c1 |
| InChI | InChI=1S/C20H17NO4/c1-12-9-13-5-3-4-6-17(13)21(12)19(22)16-11-14-10-15(24-2)7-8-18(14)25-20(16)23/h3-8,10-12H,9H2,1-2H3/t12-/m1/s1 |
| InChIKey | OOIZEASHHBZHNA-GFCCVEGCSA-N |
| XLogP | 3.39 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|