C19H14ClNO3 — CID 7347294
6-chloro-3-[(2S)-2-methyl-2,3-dihydroindole-1-carbonyl]chromen-2-one (PubChem CID 7347294) has the molecular formula C19H14ClNO3 and a molecular weight of 339.78 g/mol. Its IUPAC name is 6-chloro-3-[(2S)-2-methyl-2,3-dihydroindole-1-carbonyl]chromen-2-one.
| Compound Name | 6-chloro-3-[(2S)-2-methyl-2,3-dihydroindole-1-carbonyl]chromen-2-one |
|---|---|
| PubChem CID | 7347294 |
| Molecular Formula | C19H14ClNO3 |
| Molecular Weight | 339.78 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 6-chloro-3-[(2S)-2-methyl-2,3-dihydroindole-1-carbonyl]chromen-2-one |
| SMILES | C[C@H]1Cc2ccccc2N1C(=O)c1cc2cc(Cl)ccc2oc1=O |
| InChI | InChI=1S/C19H14ClNO3/c1-11-8-12-4-2-3-5-16(12)21(11)18(22)15-10-13-9-14(20)6-7-17(13)24-19(15)23/h2-7,9-11H,8H2,1H3/t11-/m0/s1 |
| InChIKey | AZDMEALARANOBK-NSHDSACASA-N |
| XLogP | 4.04 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.78 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|