C19H14N2O7 — CID 57388517
3-[(7,8-dihydroxy-4-methyl-2-oxochromen-3-yl)amino]-7,8-dihydroxy-1H-quinolin-2-one (PubChem CID 57388517) has the molecular formula C19H14N2O7 and a molecular weight of 382.33 g/mol. Its IUPAC name is 3-[(7,8-dihydroxy-4-methyl-2-oxochromen-3-yl)amino]-7,8-dihydroxy-1H-quinolin-2-one.
| Compound Name | 3-[(7,8-dihydroxy-4-methyl-2-oxochromen-3-yl)amino]-7,8-dihydroxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 57388517 |
| Molecular Formula | C19H14N2O7 |
| Molecular Weight | 382.33 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 3-[(7,8-dihydroxy-4-methyl-2-oxochromen-3-yl)amino]-7,8-dihydroxy-1H-quinolin-2-one |
| SMILES | Cc1c(Nc2cc3ccc(O)c(O)c3[nH]c2=O)c(=O)oc2c(O)c(O)ccc12 |
| InChI | InChI=1S/C19H14N2O7/c1-7-9-3-5-12(23)16(25)17(9)28-19(27)13(7)20-10-6-8-2-4-11(22)15(24)14(8)21-18(10)26/h2-6,20,22-25H,1H3,(H,21,26) |
| InChIKey | YASJJXGQTSIASN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 156.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|