C22H21FN2O5 — CID 6237038
3-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-7,8-dihydroxy-4-methylchromen-2-one (PubChem CID 6237038) has the molecular formula C22H21FN2O5 and a molecular weight of 412.42 g/mol. Its IUPAC name is 3-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-7,8-dihydroxy-4-methylchromen-2-one.
| Compound Name | 3-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-7,8-dihydroxy-4-methylchromen-2-one |
|---|---|
| PubChem CID | 6237038 |
| Molecular Formula | C22H21FN2O5 |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 3-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-7,8-dihydroxy-4-methylchromen-2-one |
| SMILES | Cc1c(CC(=O)N2CCN(c3ccc(F)cc3)CC2)c(=O)oc2c(O)c(O)ccc12 |
| InChI | InChI=1S/C22H21FN2O5/c1-13-16-6-7-18(26)20(28)21(16)30-22(29)17(13)12-19(27)25-10-8-24(9-11-25)15-4-2-14(23)3-5-15/h2-7,26,28H,8-12H2,1H3 |
| InChIKey | BQRGLDZRDVDONC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|