C23H23FN2O4 — CID 4894408
7-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethoxy]-3,4-dimethylchromen-2-one (PubChem CID 4894408) has the molecular formula C23H23FN2O4 and a molecular weight of 410.45 g/mol. Its IUPAC name is 7-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethoxy]-3,4-dimethylchromen-2-one.
| Compound Name | 7-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethoxy]-3,4-dimethylchromen-2-one |
|---|---|
| PubChem CID | 4894408 |
| Molecular Formula | C23H23FN2O4 |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 7-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethoxy]-3,4-dimethylchromen-2-one |
| SMILES | Cc1c(C)c2ccc(OCC(=O)N3CCN(c4ccc(F)cc4)CC3)cc2oc1=O |
| InChI | InChI=1S/C23H23FN2O4/c1-15-16(2)23(28)30-21-13-19(7-8-20(15)21)29-14-22(27)26-11-9-25(10-12-26)18-5-3-17(24)4-6-18/h3-8,13H,9-12,14H2,1-2H3 |
| InChIKey | XHEYARHCEBCUSG-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|