C27H26N2O4 — CID 46688183
N-[3-[1-[(7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl-methylamino]ethyl]phenyl]benzamide (PubChem CID 46688183) has the molecular formula C27H26N2O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is N-[3-[1-[(7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl-methylamino]ethyl]phenyl]benzamide.
| Compound Name | N-[3-[1-[(7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl-methylamino]ethyl]phenyl]benzamide |
|---|---|
| PubChem CID | 46688183 |
| Molecular Formula | C27H26N2O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | N-[3-[1-[(7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl-methylamino]ethyl]phenyl]benzamide |
| SMILES | Cc1c(O)ccc2c(CN(C)C(C)c3cccc(NC(=O)c4ccccc4)c3)cc(=O)oc12 |
| InChI | InChI=1S/C27H26N2O4/c1-17-24(30)13-12-23-21(15-25(31)33-26(17)23)16-29(3)18(2)20-10-7-11-22(14-20)28-27(32)19-8-5-4-6-9-19/h4-15,18,30H,16H2,1-3H3,(H,28,32) |
| InChIKey | VBQIXVCRBZTHRH-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|