C23H26ClN2O4S+ — CID 2124723
6-chloro-4-[[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-7-methylchromen-2-one (PubChem CID 2124723) has the molecular formula C23H26ClN2O4S+ and a molecular weight of 461.99 g/mol. Its IUPAC name is 6-chloro-4-[[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-7-methylchromen-2-one.
| Compound Name | 6-chloro-4-[[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-7-methylchromen-2-one |
|---|---|
| PubChem CID | 2124723 |
| Molecular Formula | C23H26ClN2O4S+ |
| Molecular Weight | 461.99 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | 6-chloro-4-[[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-7-methylchromen-2-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[NH+](Cc3cc(=O)oc4cc(C)c(Cl)cc34)CC2)cc1C |
| InChI | InChI=1S/C23H25ClN2O4S/c1-15-4-5-19(10-16(15)2)31(28,29)26-8-6-25(7-9-26)14-18-12-23(27)30-22-11-17(3)21(24)13-20(18)22/h4-5,10-13H,6-9,14H2,1-3H3/p+1 |
| InChIKey | MMDHBRPDULJDFZ-UHFFFAOYSA-O |
| XLogP | 2.46 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.99 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|