C25H27NO7S — CID 55928958
(6,7-dimethyl-2-oxochromen-4-yl)methyl (2S)-1-(3,4-dimethylphenyl)sulfonyl-4-hydroxypyrrolidine-2-carboxylate (PubChem CID 55928958) has the molecular formula C25H27NO7S and a molecular weight of 485.56 g/mol. Its IUPAC name is (6,7-dimethyl-2-oxochromen-4-yl)methyl (2S)-1-(3,4-dimethylphenyl)sulfonyl-4-hydroxypyrrolidine-2-carboxylate.
| Compound Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl (2S)-1-(3,4-dimethylphenyl)sulfonyl-4-hydroxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 55928958 |
| Molecular Formula | C25H27NO7S |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl (2S)-1-(3,4-dimethylphenyl)sulfonyl-4-hydroxypyrrolidine-2-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(O)C[C@H]2C(=O)OCc2cc(=O)oc3cc(C)c(C)cc23)cc1C |
| InChI | InChI=1S/C25H27NO7S/c1-14-5-6-20(7-15(14)2)34(30,31)26-12-19(27)11-22(26)25(29)32-13-18-10-24(28)33-23-9-17(4)16(3)8-21(18)23/h5-10,19,22,27H,11-13H2,1-4H3/t19?,22-/m0/s1 |
| InChIKey | YBXKJRFYKUIOSY-BPARTEKVSA-N |
| XLogP | 2.89 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|