C24H27FN2O3 — CID 97194134
4-[[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-fluoroanilino]methyl]-7-ethylchromen-2-one (PubChem CID 97194134) has the molecular formula C24H27FN2O3 and a molecular weight of 410.49 g/mol. Its IUPAC name is 4-[[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-fluoroanilino]methyl]-7-ethylchromen-2-one.
| Compound Name | 4-[[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-fluoroanilino]methyl]-7-ethylchromen-2-one |
|---|---|
| PubChem CID | 97194134 |
| Molecular Formula | C24H27FN2O3 |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 4-[[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-fluoroanilino]methyl]-7-ethylchromen-2-one |
| SMILES | CCc1ccc2c(CNc3ccc(N4C[C@H](C)O[C@@H](C)C4)c(F)c3)cc(=O)oc2c1 |
| InChI | InChI=1S/C24H27FN2O3/c1-4-17-5-7-20-18(10-24(28)30-23(20)9-17)12-26-19-6-8-22(21(25)11-19)27-13-15(2)29-16(3)14-27/h5-11,15-16,26H,4,12-14H2,1-3H3/t15-,16-/m0/s1 |
| InChIKey | JXGOCZNXWMNTOX-HOTGVXAUSA-N |
| XLogP | 4.72 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|