C14H9BrClN3O — CID 48923577
3-[(4-bromo-2-chlorophenyl)methyl]-1,2,3-benzotriazin-4-one (PubChem CID 48923577) has the molecular formula C14H9BrClN3O and a molecular weight of 350.60 g/mol. Its IUPAC name is 3-[(4-bromo-2-chlorophenyl)methyl]-1,2,3-benzotriazin-4-one.
| Compound Name | 3-[(4-bromo-2-chlorophenyl)methyl]-1,2,3-benzotriazin-4-one |
|---|---|
| PubChem CID | 48923577 |
| Molecular Formula | C14H9BrClN3O |
| Molecular Weight | 350.60 g/mol |
| Exact Mass | 348.96 |
| IUPAC Name | 3-[(4-bromo-2-chlorophenyl)methyl]-1,2,3-benzotriazin-4-one |
| SMILES | O=c1c2ccccc2nnn1Cc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C14H9BrClN3O/c15-10-6-5-9(12(16)7-10)8-19-14(20)11-3-1-2-4-13(11)17-18-19/h1-7H,8H2 |
| InChIKey | MTLLOTWJAIPVNU-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.60 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |