C14H20N2O3 — CID 59011747
1-[(3,4-dimethoxyphenyl)methyl]-3-methyl-1,3-diazinan-2-one (PubChem CID 59011747) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-3-methyl-1,3-diazinan-2-one.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-methyl-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 59011747 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-methyl-1,3-diazinan-2-one |
| SMILES | COc1ccc(CN2CCCN(C)C2=O)cc1OC |
| InChI | InChI=1S/C14H20N2O3/c1-15-7-4-8-16(14(15)17)10-11-5-6-12(18-2)13(9-11)19-3/h5-6,9H,4,7-8,10H2,1-3H3 |
| InChIKey | COEVYZHLAAZMAV-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |